C28H45N5O7S2 — CID 54045299
N-[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-N-(cyclohexylmethyl)-4-methylsulfonylbutanamide (PubChem CID 54045299) has the molecular formula C28H45N5O7S2 and a molecular weight of 627.83 g/mol. Its IUPAC name is N-[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-N-(cyclohexylmethyl)-4-methylsulfonylbutanamide.
| Compound Name | N-[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-N-(cyclohexylmethyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 54045299 |
| Molecular Formula | C28H45N5O7S2 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | N-[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-N-(cyclohexylmethyl)-4-methylsulfonylbutanamide |
| SMILES | C/C(N)=N\CCCC(C=O)NC(=O)CN(CC1CCCCC1)C(=O)C(CCS(C)(=O)=O)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C28H45N5O7S2/c1-22(29)30-16-9-14-25(20-34)31-27(35)19-33(18-23-10-5-3-6-11-23)28(36)26(15-17-41(2,37)38)32-42(39,40)21-24-12-7-4-8-13-24/h4,7-8,12-13,20,23,25-26,32H,3,5-6,9-11,14-19,21H2,1-2H3,(H2,29,30)(H,31,35) |
| InChIKey | QCQKHMVABLDOEU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 185.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|