C23H36N12O5S — CID 130388717
(2S)-2-[(3-carbamimidoylphenyl)methylsulfonylamino]-N-[2-[[(2S)-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-N-methyl-4-(2H-tetrazol-5-yl)butanamide (PubChem CID 130388717) has the molecular formula C23H36N12O5S and a molecular weight of 592.69 g/mol. Its IUPAC name is (2S)-2-[(3-carbamimidoylphenyl)methylsulfonylamino]-N-[2-[[(2S)-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-N-methyl-4-(2H-tetrazol-5-yl)butanamide.
| Compound Name | (2S)-2-[(3-carbamimidoylphenyl)methylsulfonylamino]-N-[2-[[(2S)-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-N-methyl-4-(2H-tetrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 130388717 |
| Molecular Formula | C23H36N12O5S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | (2S)-2-[(3-carbamimidoylphenyl)methylsulfonylamino]-N-[2-[[(2S)-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-N-methyl-4-(2H-tetrazol-5-yl)butanamide |
| SMILES | [H]/N=C(\N)c1cccc(CS(=O)(=O)N[C@@H](CCc2nn[nH]n2)C(=O)N(C)CC(=O)N[C@H](C=O)CCCCN=C(N)N)c1 |
| InChI | InChI=1S/C23H36N12O5S/c1-35(12-20(37)29-17(13-36)7-2-3-10-28-23(26)27)22(38)18(8-9-19-30-33-34-31-19)32-41(39,40)14-15-5-4-6-16(11-15)21(24)25/h4-6,11,13,17-18,32H,2-3,7-10,12,14H2,1H3,(H3,24,25)(H,29,37)(H4,26,27,28)(H,30,31,33,34)/t17-,18-/m0/s1 |
| InChIKey | AJBUFJWIQTUDQA-ROUUACIJSA-N |
| XLogP | -2.51 |
| TPSA | 281.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|