C22H33N7O7S — CID 159030826
(4S)-5-[[2-[[(2S)-7-amino-7-imino-1-oxoheptan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[(2-carbamimidoylphenyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 159030826) has the molecular formula C22H33N7O7S and a molecular weight of 539.62 g/mol. Its IUPAC name is (4S)-5-[[2-[[(2S)-7-amino-7-imino-1-oxoheptan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[(2-carbamimidoylphenyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[2-[[(2S)-7-amino-7-imino-1-oxoheptan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[(2-carbamimidoylphenyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 159030826 |
| Molecular Formula | C22H33N7O7S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (4S)-5-[[2-[[(2S)-7-amino-7-imino-1-oxoheptan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[(2-carbamimidoylphenyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)CCCC[C@@H](C=O)NC(=O)CN(C)C(=O)[C@H](CCC(=O)O)NS(=O)(=O)c1ccccc1/C(N)=N/[H] |
| InChI | InChI=1S/C22H33N7O7S/c1-29(12-19(31)27-14(13-30)6-2-5-9-18(23)24)22(34)16(10-11-20(32)33)28-37(35,36)17-8-4-3-7-15(17)21(25)26/h3-4,7-8,13-14,16,28H,2,5-6,9-12H2,1H3,(H3,23,24)(H3,25,26)(H,27,31)(H,32,33)/t14-,16-/m0/s1 |
| InChIKey | JUWANRNBBKLQCT-HOCLYGCPSA-N |
| XLogP | -0.88 |
| TPSA | 249.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|