C24H38N8O7S — CID 10196750
methyl 5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[[3-(N'-methylcarbamimidoyl)phenyl]methylsulfonylamino]-5-oxopentanoate (PubChem CID 10196750) has the molecular formula C24H38N8O7S and a molecular weight of 582.68 g/mol. Its IUPAC name is methyl 5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[[3-(N'-methylcarbamimidoyl)phenyl]methylsulfonylamino]-5-oxopentanoate.
| Compound Name | methyl 5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[[3-(N'-methylcarbamimidoyl)phenyl]methylsulfonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10196750 |
| Molecular Formula | C24H38N8O7S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | methyl 5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-4-[[3-(N'-methylcarbamimidoyl)phenyl]methylsulfonylamino]-5-oxopentanoate |
| SMILES | C/N=C(\N)c1cccc(CS(=O)(=O)NC(CCC(=O)OC)C(=O)N(C)CC(=O)NC(C=O)CCCN=C(N)N)c1 |
| InChI | InChI=1S/C24H38N8O7S/c1-28-22(25)17-7-4-6-16(12-17)15-40(37,38)31-19(9-10-21(35)39-3)23(36)32(2)13-20(34)30-18(14-33)8-5-11-29-24(26)27/h4,6-7,12,14,18-19,31H,5,8-11,13,15H2,1-3H3,(H2,25,28)(H,30,34)(H4,26,27,29) |
| InChIKey | BROUAESAQKXHJH-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 241.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|