C24H34N6O9 — CID 162212714
[(2R)-3-[[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-[3-(3-carbamoylphenyl)propoxycarbonylamino]-3-oxopropyl] hydrogen carbonate (PubChem CID 162212714) has the molecular formula C24H34N6O9 and a molecular weight of 550.57 g/mol. Its IUPAC name is [(2R)-3-[[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-[3-(3-carbamoylphenyl)propoxycarbonylamino]-3-oxopropyl] hydrogen carbonate.
| Compound Name | [(2R)-3-[[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-[3-(3-carbamoylphenyl)propoxycarbonylamino]-3-oxopropyl] hydrogen carbonate |
|---|---|
| PubChem CID | 162212714 |
| Molecular Formula | C24H34N6O9 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(2R)-3-[[2-[[5-(1-aminoethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-[3-(3-carbamoylphenyl)propoxycarbonylamino]-3-oxopropyl] hydrogen carbonate |
| SMILES | C/C(N)=N\CCCC(C=O)NC(=O)CNC(=O)[C@@H](COC(=O)O)NC(=O)OCCCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C24H34N6O9/c1-15(25)27-9-3-8-18(13-31)29-20(32)12-28-22(34)19(14-39-24(36)37)30-23(35)38-10-4-6-16-5-2-7-17(11-16)21(26)33/h2,5,7,11,13,18-19H,3-4,6,8-10,12,14H2,1H3,(H2,25,27)(H2,26,33)(H,28,34)(H,29,32)(H,30,35)(H,36,37)/t18?,19-/m1/s1 |
| InChIKey | ZTBHXUUXQIPBCM-MUMRKEEXSA-N |
| XLogP | -0.54 |
| TPSA | 241.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|