C23H34N8O7 — CID 10196322
4-[(3-carbamimidoylphenyl)methyl]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-(methoxycarbonylamino)-5-oxopentanoic acid (PubChem CID 10196322) has the molecular formula C23H34N8O7 and a molecular weight of 534.57 g/mol. Its IUPAC name is 4-[(3-carbamimidoylphenyl)methyl]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-(methoxycarbonylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(3-carbamimidoylphenyl)methyl]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-(methoxycarbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10196322 |
| Molecular Formula | C23H34N8O7 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 4-[(3-carbamimidoylphenyl)methyl]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-4-(methoxycarbonylamino)-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1cccc(CC(CCC(=O)O)(NC(=O)OC)C(=O)NCC(=O)NC(C=O)CCCN=C(N)N)c1 |
| InChI | InChI=1S/C23H34N8O7/c1-38-22(37)31-23(8-7-18(34)35,11-14-4-2-5-15(10-14)19(24)25)20(36)29-12-17(33)30-16(13-32)6-3-9-28-21(26)27/h2,4-5,10,13,16H,3,6-9,11-12H2,1H3,(H3,24,25)(H,29,36)(H,30,33)(H,31,37)(H,34,35)(H4,26,27,28) |
| InChIKey | LAKMGIWRNCSVTO-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 265.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|