C22H29N5O6S2 — CID 21019801
methyl N-[2-benzyl-1-[[2-[(5-carbamimidoylthiophen-2-yl)methylamino]-2-oxoethyl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate (PubChem CID 21019801) has the molecular formula C22H29N5O6S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is methyl N-[2-benzyl-1-[[2-[(5-carbamimidoylthiophen-2-yl)methylamino]-2-oxoethyl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[2-benzyl-1-[[2-[(5-carbamimidoylthiophen-2-yl)methylamino]-2-oxoethyl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 21019801 |
| Molecular Formula | C22H29N5O6S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | methyl N-[2-benzyl-1-[[2-[(5-carbamimidoylthiophen-2-yl)methylamino]-2-oxoethyl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CNC(=O)C(CCS(C)(=O)=O)(Cc2ccccc2)NC(=O)OC)s1 |
| InChI | InChI=1S/C22H29N5O6S2/c1-33-21(30)27-22(10-11-35(2,31)32,12-15-6-4-3-5-7-15)20(29)26-14-18(28)25-13-16-8-9-17(34-16)19(23)24/h3-9H,10-14H2,1-2H3,(H3,23,24)(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | DXBZQPUPOTXUKR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 180.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|