C7H11N3S — CID 59098892
5-(methylaminomethyl)thiophene-2-carboximidamide (PubChem CID 59098892) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-(methylaminomethyl)thiophene-2-carboximidamide.
| Compound Name | 5-(methylaminomethyl)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 59098892 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-(methylaminomethyl)thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC)s1 |
| InChI | InChI=1S/C7H11N3S/c1-10-4-5-2-3-6(11-5)7(8)9/h2-3,10H,4H2,1H3,(H3,8,9) |
| InChIKey | IPJPKKDGSWPRQJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|