C21H32N8O7S — CID 10289582
4-[(2-carbamimidoylphenyl)sulfonylamino]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxopentanoic acid (PubChem CID 10289582) has the molecular formula C21H32N8O7S and a molecular weight of 540.60 g/mol. Its IUPAC name is 4-[(2-carbamimidoylphenyl)sulfonylamino]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxopentanoic acid.
| Compound Name | 4-[(2-carbamimidoylphenyl)sulfonylamino]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10289582 |
| Molecular Formula | C21H32N8O7S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 4-[(2-carbamimidoylphenyl)sulfonylamino]-5-[[2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccccc1S(=O)(=O)NC(CCC(=O)O)C(=O)N(C)CC(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C21H32N8O7S/c1-29(11-17(31)27-13(12-30)5-4-10-26-21(24)25)20(34)15(8-9-18(32)33)28-37(35,36)16-7-3-2-6-14(16)19(22)23/h2-3,6-7,12-13,15,28H,4-5,8-11H2,1H3,(H3,22,23)(H,27,31)(H,32,33)(H4,24,25,26) |
| InChIKey | UFKSOYJVIZFEBW-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 264.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|