C20H27N7O6S — CID 18172489
2-[5-(benzylsulfonylamino)-3-methyl-2,6-dioxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide (PubChem CID 18172489) has the molecular formula C20H27N7O6S and a molecular weight of 493.55 g/mol. Its IUPAC name is 2-[5-(benzylsulfonylamino)-3-methyl-2,6-dioxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide.
| Compound Name | 2-[5-(benzylsulfonylamino)-3-methyl-2,6-dioxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 18172489 |
| Molecular Formula | C20H27N7O6S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 2-[5-(benzylsulfonylamino)-3-methyl-2,6-dioxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide |
| SMILES | Cn1cc(NS(=O)(=O)Cc2ccccc2)c(=O)n(CC(=O)NC(C=O)CCCN=C(N)N)c1=O |
| InChI | InChI=1S/C20H27N7O6S/c1-26-10-16(25-34(32,33)13-14-6-3-2-4-7-14)18(30)27(20(26)31)11-17(29)24-15(12-28)8-5-9-23-19(21)22/h2-4,6-7,10,12,15,25H,5,8-9,11,13H2,1H3,(H,24,29)(H4,21,22,23) |
| InChIKey | JNTPBLDQGMLTBH-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 200.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|