C21H26F3N7O8S — CID 158521003
2-[5-(benzylsulfonylamino)-2,4-dioxo-1H-pyrimidin-3-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 158521003) has the molecular formula C21H26F3N7O8S and a molecular weight of 593.54 g/mol. Its IUPAC name is 2-[5-(benzylsulfonylamino)-2,4-dioxo-1H-pyrimidin-3-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[5-(benzylsulfonylamino)-2,4-dioxo-1H-pyrimidin-3-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158521003 |
| Molecular Formula | C21H26F3N7O8S |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 2-[5-(benzylsulfonylamino)-2,4-dioxo-1H-pyrimidin-3-yl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCC(C=O)NC(=O)Cn1c(=O)[nH]cc(NS(=O)(=O)Cc2ccccc2)c1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N7O6S.C2HF3O2/c20-18(21)22-8-4-7-14(11-27)24-16(28)10-26-17(29)15(9-23-19(26)30)25-33(31,32)12-13-5-2-1-3-6-13;3-2(4,5)1(6)7/h1-3,5-6,9,11,14,25H,4,7-8,10,12H2,(H,23,30)(H,24,28)(H4,20,21,22);(H,6,7) |
| InChIKey | JBCMXMBSQUNAIM-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 248.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|