C22H37N9O5S — CID 91012140
(2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-methylpentanamide (PubChem CID 91012140) has the molecular formula C22H37N9O5S and a molecular weight of 539.66 g/mol. Its IUPAC name is (2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-methylpentanamide.
| Compound Name | (2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 91012140 |
| Molecular Formula | C22H37N9O5S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | (2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-methylpentanamide |
| SMILES | CN(CC(=O)N[C@H](C=O)CCCN=C(N)N)C(=O)[C@@H](CCCN=C(N)N)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H37N9O5S/c1-31(13-19(33)29-17(14-32)9-5-11-27-21(23)24)20(34)18(10-6-12-28-22(25)26)30-37(35,36)15-16-7-3-2-4-8-16/h2-4,7-8,14,17-18,30H,5-6,9-13,15H2,1H3,(H,29,33)(H4,23,24,27)(H4,25,26,28)/t17-,18+/m0/s1 |
| InChIKey | JCNLZVRNXSDYLN-ZWKOTPCHSA-N |
| XLogP | -2.28 |
| TPSA | 241.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|