C31H46N8O4 — CID 144640595
N-(6-amino-1-oxohexan-2-yl)-5-(diaminomethylideneamino)-2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanamide (PubChem CID 144640595) has the molecular formula C31H46N8O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is N-(6-amino-1-oxohexan-2-yl)-5-(diaminomethylideneamino)-2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanamide.
| Compound Name | N-(6-amino-1-oxohexan-2-yl)-5-(diaminomethylideneamino)-2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 144640595 |
| Molecular Formula | C31H46N8O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | N-(6-amino-1-oxohexan-2-yl)-5-(diaminomethylideneamino)-2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanamide |
| SMILES | CNC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(C=O)CCCCN |
| InChI | InChI=1S/C31H46N8O4/c1-35-26(19-22-11-4-2-5-12-22)29(42)39-27(20-23-13-6-3-7-14-23)30(43)38-25(16-10-18-36-31(33)34)28(41)37-24(21-40)15-8-9-17-32/h2-7,11-14,21,24-27,35H,8-10,15-20,32H2,1H3,(H,37,41)(H,38,43)(H,39,42)(H4,33,34,36) |
| InChIKey | RGFRUGRWISJJKG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 206.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|