C35H45N7O5 — CID 44568720
N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(2S)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]pentan-2-yl]amino]-1-oxohexan-2-yl]benzamide (PubChem CID 44568720) has the molecular formula C35H45N7O5 and a molecular weight of 643.79 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(2S)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]pentan-2-yl]amino]-1-oxohexan-2-yl]benzamide.
| Compound Name | N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(2S)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]pentan-2-yl]amino]-1-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 44568720 |
| Molecular Formula | C35H45N7O5 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(2S)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]pentan-2-yl]amino]-1-oxohexan-2-yl]benzamide |
| SMILES | NCCCC[C@H](NC(=O)c1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H45N7O5/c36-20-8-7-14-30(41-32(44)27-12-5-2-6-13-27)34(46)42-31(15-9-21-39-35(37)38)33(45)40-28(23-43)22-25-16-18-29(19-17-25)47-24-26-10-3-1-4-11-26/h1-6,10-13,16-19,23,28,30-31H,7-9,14-15,20-22,24,36H2,(H,40,45)(H,41,44)(H,42,46)(H4,37,38,39)/t28-,30-,31-/m0/s1 |
| InChIKey | IQBKNIALWAXJPO-ASVWTAOFSA-N |
| XLogP | 1.96 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|