C29H44N8O5 — CID 25107574
N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]-6-hydroxynaphthalene-2-carboxamide (PubChem CID 25107574) has the molecular formula C29H44N8O5 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]-6-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]-6-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 25107574 |
| Molecular Formula | C29H44N8O5 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | N-[(2S)-6-amino-1-[[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]-6-hydroxynaphthalene-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)c1ccc2cc(O)ccc2c1)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C29H44N8O5/c30-13-3-1-7-24(27(41)35-22(18-38)6-5-15-34-29(32)33)37-28(42)25(8-2-4-14-31)36-26(40)21-10-9-20-17-23(39)12-11-19(20)16-21/h9-12,16-18,22,24-25,39H,1-8,13-15,30-31H2,(H,35,41)(H,36,40)(H,37,42)(H4,32,33,34)/t22-,24-,25-/m0/s1 |
| InChIKey | YBLAARWBAYORCW-HVCNVCAESA-N |
| XLogP | 0.12 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|