C36H48N8O5 — CID 127040818
(2S)-6-amino-N-[(1R)-2-amino-2-oxo-1-(4-phenylmethoxyphenyl)ethyl]-2-[[(2S)-5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoyl]amino]hexanamide (PubChem CID 127040818) has the molecular formula C36H48N8O5 and a molecular weight of 672.83 g/mol. Its IUPAC name is (2S)-6-amino-N-[(1R)-2-amino-2-oxo-1-(4-phenylmethoxyphenyl)ethyl]-2-[[(2S)-5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[(1R)-2-amino-2-oxo-1-(4-phenylmethoxyphenyl)ethyl]-2-[[(2S)-5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 127040818 |
| Molecular Formula | C36H48N8O5 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | (2S)-6-amino-N-[(1R)-2-amino-2-oxo-1-(4-phenylmethoxyphenyl)ethyl]-2-[[(2S)-5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoyl]amino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)CCc1ccccc1)C(=O)N[C@@H](C(N)=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H48N8O5/c37-22-8-7-14-30(35(48)44-32(33(38)46)27-17-19-28(20-18-27)49-24-26-12-5-2-6-13-26)43-34(47)29(15-9-23-41-36(39)40)42-31(45)21-16-25-10-3-1-4-11-25/h1-6,10-13,17-20,29-30,32H,7-9,14-16,21-24,37H2,(H2,38,46)(H,42,45)(H,43,47)(H,44,48)(H4,39,40,41)/t29-,30-,32+/m0/s1 |
| InChIKey | XQKMIMGNLZGPMO-LHHUKBANSA-N |
| XLogP | 1.69 |
| TPSA | 230.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|