C25H39N7O7S — CID 146816696
methyl 5-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxo-4-[(3-propanimidoylphenyl)methylsulfonylamino]pentanoate (PubChem CID 146816696) has the molecular formula C25H39N7O7S and a molecular weight of 581.70 g/mol. Its IUPAC name is methyl 5-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxo-4-[(3-propanimidoylphenyl)methylsulfonylamino]pentanoate.
| Compound Name | methyl 5-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxo-4-[(3-propanimidoylphenyl)methylsulfonylamino]pentanoate |
|---|---|
| PubChem CID | 146816696 |
| Molecular Formula | C25H39N7O7S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | methyl 5-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylamino]-5-oxo-4-[(3-propanimidoylphenyl)methylsulfonylamino]pentanoate |
| SMILES | [H]/N=C(\CC)c1cccc(CS(=O)(=O)NC(CCC(=O)OC)C(=O)N(C)CC(=O)N[C@H](C=O)CCCN=C(N)N)c1 |
| InChI | InChI=1S/C25H39N7O7S/c1-4-20(26)18-8-5-7-17(13-18)16-40(37,38)31-21(10-11-23(35)39-3)24(36)32(2)14-22(34)30-19(15-33)9-6-12-29-25(27)28/h5,7-8,13,15,19,21,26,31H,4,6,9-12,14,16H2,1-3H3,(H,30,34)(H4,27,28,29)/b26-20+/t19-,21?/m0/s1 |
| InChIKey | SBFUJCSDOFFJMI-BZFQDYQYSA-N |
| XLogP | -0.60 |
| TPSA | 227.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|