C27H32N6O5S — CID 22943380
2-[3-(benzenesulfonamido)-2-oxo-4-(2-phenylethyl)-1-pyridinyl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide (PubChem CID 22943380) has the molecular formula C27H32N6O5S and a molecular weight of 552.66 g/mol. Its IUPAC name is 2-[3-(benzenesulfonamido)-2-oxo-4-(2-phenylethyl)-1-pyridinyl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide.
| Compound Name | 2-[3-(benzenesulfonamido)-2-oxo-4-(2-phenylethyl)-1-pyridinyl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 22943380 |
| Molecular Formula | C27H32N6O5S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 2-[3-(benzenesulfonamido)-2-oxo-4-(2-phenylethyl)-1-pyridinyl]-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide |
| SMILES | NC(N)=NCCCC(C=O)NC(=O)Cn1ccc(CCc2ccccc2)c(NS(=O)(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C27H32N6O5S/c28-27(29)30-16-7-10-22(19-34)31-24(35)18-33-17-15-21(14-13-20-8-3-1-4-9-20)25(26(33)36)32-39(37,38)23-11-5-2-6-12-23/h1-6,8-9,11-12,15,17,19,22,32H,7,10,13-14,16,18H2,(H,31,35)(H4,28,29,30) |
| InChIKey | GXVHSUBUGMFTEE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|