C24H31N5O5 — CID 22943377
2-[3-acetamido-4-(2-hydroxy-2-phenylethyl)-2-oxo-1-pyridinyl]-N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]acetamide (PubChem CID 22943377) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[3-acetamido-4-(2-hydroxy-2-phenylethyl)-2-oxo-1-pyridinyl]-N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]acetamide.
| Compound Name | 2-[3-acetamido-4-(2-hydroxy-2-phenylethyl)-2-oxo-1-pyridinyl]-N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 22943377 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[3-acetamido-4-(2-hydroxy-2-phenylethyl)-2-oxo-1-pyridinyl]-N-[5-(1-aminoethenylamino)-1-oxopentan-2-yl]acetamide |
| SMILES | C=C(N)NCCCC(C=O)NC(=O)Cn1ccc(CC(O)c2ccccc2)c(NC(C)=O)c1=O |
| InChI | InChI=1S/C24H31N5O5/c1-16(25)26-11-6-9-20(15-30)28-22(33)14-29-12-10-19(23(24(29)34)27-17(2)31)13-21(32)18-7-4-3-5-8-18/h3-5,7-8,10,12,15,20-21,26,32H,1,6,9,11,13-14,25H2,2H3,(H,27,31)(H,28,33) |
| InChIKey | WLEAKSUFFVNCHI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 155.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|