C26H31N5O3 — CID 18658360
N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-5-(4,5-diphenyl-1,3-oxazol-2-yl)pentanamide (PubChem CID 18658360) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-5-(4,5-diphenyl-1,3-oxazol-2-yl)pentanamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-5-(4,5-diphenyl-1,3-oxazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 18658360 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-5-(4,5-diphenyl-1,3-oxazol-2-yl)pentanamide |
| SMILES | NC(N)=NCCC[C@@H](C=O)NC(=O)CCCCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C26H31N5O3/c27-26(28)29-17-9-14-21(18-32)30-22(33)15-7-8-16-23-31-24(19-10-3-1-4-11-19)25(34-23)20-12-5-2-6-13-20/h1-6,10-13,18,21H,7-9,14-17H2,(H,30,33)(H4,27,28,29)/t21-/m0/s1 |
| InChIKey | ITNVGXGHVXTMLU-NRFANRHFSA-N |
| XLogP | 3.46 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|