C22H22FN5O5S — CID 10163266
N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide (PubChem CID 10163266) has the molecular formula C22H22FN5O5S and a molecular weight of 487.51 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10163266 |
| Molecular Formula | C22H22FN5O5S |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2cccc(NS(=O)(=O)c3cccc(OC)c3)c2=O)c(F)c1 |
| InChI | InChI=1S/C22H22FN5O5S/c1-33-16-4-2-5-17(11-16)34(31,32)27-19-6-3-9-28(22(19)30)13-20(29)26-12-15-8-7-14(21(24)25)10-18(15)23/h2-11,27H,12-13H2,1H3,(H3,24,25)(H,26,29) |
| InChIKey | QEIZOZWDTCKRDF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|