C23H25N5O6S — CID 10185327
N-[(4-carbamimidoyl-2-methoxyphenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide (PubChem CID 10185327) has the molecular formula C23H25N5O6S and a molecular weight of 499.55 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-2-methoxyphenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[(4-carbamimidoyl-2-methoxyphenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10185327 |
| Molecular Formula | C23H25N5O6S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N-[(4-carbamimidoyl-2-methoxyphenyl)methyl]-2-[3-[(3-methoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2cccc(NS(=O)(=O)c3cccc(OC)c3)c2=O)c(OC)c1 |
| InChI | InChI=1S/C23H25N5O6S/c1-33-17-5-3-6-18(12-17)35(31,32)27-19-7-4-10-28(23(19)30)14-21(29)26-13-16-9-8-15(22(24)25)11-20(16)34-2/h3-12,27H,13-14H2,1-2H3,(H3,24,25)(H,26,29) |
| InChIKey | KLBBHAHSBBTWTB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 165.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|