C23H25N3O4S2 — CID 57236719
4-[2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]phenyl]-2-sulfanylethyl]benzenecarboximidamide (PubChem CID 57236719) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is 4-[2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]phenyl]-2-sulfanylethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]phenyl]-2-sulfanylethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 57236719 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-[2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]phenyl]-2-sulfanylethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(S)c2ccccc2NS(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-29-20-12-11-17(14-21(20)30-2)32(27,28)26-19-6-4-3-5-18(19)22(31)13-15-7-9-16(10-8-15)23(24)25/h3-12,14,22,26,31H,13H2,1-2H3,(H3,24,25) |
| InChIKey | FQDKTVRGAVIPSU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|