C23H31N7O5S2 — CID 18717737
2-(3-benzyl-4-methylperoxysulfanyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide (PubChem CID 18717737) has the molecular formula C23H31N7O5S2 and a molecular weight of 549.68 g/mol. Its IUPAC name is 2-(3-benzyl-4-methylperoxysulfanyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide.
| Compound Name | 2-(3-benzyl-4-methylperoxysulfanyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 18717737 |
| Molecular Formula | C23H31N7O5S2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 2-(3-benzyl-4-methylperoxysulfanyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
| SMILES | COOSN1CCN(CC(=O)NC(CCCN=C(N)N)C(=O)c2nccs2)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C23H31N7O5S2/c1-34-35-37-30-12-11-29(22(33)18(30)14-16-6-3-2-4-7-16)15-19(31)28-17(8-5-9-27-23(24)25)20(32)21-26-10-13-36-21/h2-4,6-7,10,13,17-18H,5,8-9,11-12,14-15H2,1H3,(H,28,31)(H4,24,25,27) |
| InChIKey | GWPVGSGKJWIEMJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 165.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|