C23H28N8O3S2 — CID 20843088
2-[5-(benzylamino)-2-methylsulfanyl-6-oxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide (PubChem CID 20843088) has the molecular formula C23H28N8O3S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is 2-[5-(benzylamino)-2-methylsulfanyl-6-oxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide.
| Compound Name | 2-[5-(benzylamino)-2-methylsulfanyl-6-oxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 20843088 |
| Molecular Formula | C23H28N8O3S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 2-[5-(benzylamino)-2-methylsulfanyl-6-oxopyrimidin-1-yl]-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
| SMILES | CSc1ncc(NCc2ccccc2)c(=O)n1CC(=O)NC(CCCN=C(N)N)C(=O)c1nccs1 |
| InChI | InChI=1S/C23H28N8O3S2/c1-35-23-29-13-17(28-12-15-6-3-2-4-7-15)21(34)31(23)14-18(32)30-16(8-5-9-27-22(24)25)19(33)20-26-10-11-36-20/h2-4,6-7,10-11,13,16,28H,5,8-9,12,14H2,1H3,(H,30,32)(H4,24,25,27) |
| InChIKey | NSVPIISNZVMCCY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 170.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|