C28H34FN9O4S — CID 142970546
N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-[1-(4-fluorophenyl)ethylcarbamoylamino]-3-pyridin-3-ylpropanamide (PubChem CID 142970546) has the molecular formula C28H34FN9O4S and a molecular weight of 611.70 g/mol. Its IUPAC name is N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-[1-(4-fluorophenyl)ethylcarbamoylamino]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-[1-(4-fluorophenyl)ethylcarbamoylamino]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 142970546 |
| Molecular Formula | C28H34FN9O4S |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | N-[2-[[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-[1-(4-fluorophenyl)ethylcarbamoylamino]-3-pyridin-3-ylpropanamide |
| SMILES | CC(NC(=O)NC(Cc1cccnc1)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)c1nccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H34FN9O4S/c1-17(19-6-8-20(29)9-7-19)36-28(42)38-22(14-18-4-2-10-32-15-18)25(41)35-16-23(39)37-21(5-3-11-34-27(30)31)24(40)26-33-12-13-43-26/h2,4,6-10,12-13,15,17,21-22H,3,5,11,14,16H2,1H3,(H,35,41)(H,37,39)(H4,30,31,34)(H2,36,38,42) |
| InChIKey | YLBDGKHJWZBIOJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 206.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|