C35H41ClN8O2S — CID 142028736
2-[4-[[2-[5-chloro-2-oxo-6-(2-phenylethyl)-3-(2-phenylethylamino)pyrazin-1-yl]-1-cyclobutylideneethyl]amino]-5-oxo-5-(1,3-thiazol-2-yl)pentyl]guanidine (PubChem CID 142028736) has the molecular formula C35H41ClN8O2S and a molecular weight of 673.29 g/mol. Its IUPAC name is 2-[4-[[2-[5-chloro-2-oxo-6-(2-phenylethyl)-3-(2-phenylethylamino)pyrazin-1-yl]-1-cyclobutylideneethyl]amino]-5-oxo-5-(1,3-thiazol-2-yl)pentyl]guanidine.
| Compound Name | 2-[4-[[2-[5-chloro-2-oxo-6-(2-phenylethyl)-3-(2-phenylethylamino)pyrazin-1-yl]-1-cyclobutylideneethyl]amino]-5-oxo-5-(1,3-thiazol-2-yl)pentyl]guanidine |
|---|---|
| PubChem CID | 142028736 |
| Molecular Formula | C35H41ClN8O2S |
| Molecular Weight | 673.29 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 2-[4-[[2-[5-chloro-2-oxo-6-(2-phenylethyl)-3-(2-phenylethylamino)pyrazin-1-yl]-1-cyclobutylideneethyl]amino]-5-oxo-5-(1,3-thiazol-2-yl)pentyl]guanidine |
| SMILES | NC(N)=NCCCC(NC(Cn1c(CCc2ccccc2)c(Cl)nc(NCCc2ccccc2)c1=O)=C1CCC1)C(=O)c1nccs1 |
| InChI | InChI=1S/C35H41ClN8O2S/c36-31-29(17-16-24-9-3-1-4-10-24)44(34(46)32(43-31)39-20-18-25-11-5-2-6-12-25)23-28(26-13-7-14-26)42-27(15-8-19-41-35(37)38)30(45)33-40-21-22-47-33/h1-6,9-12,21-22,27,42H,7-8,13-20,23H2,(H,39,43)(H4,37,38,41) |
| InChIKey | GLNOAEWEEZCIHZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|