C14H21AcN6O3S- — CID 59916037
actinium;(2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide (PubChem CID 59916037) has the molecular formula C14H21AcN6O3S- and a molecular weight of 580.43 g/mol. Its IUPAC name is actinium;(2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide.
| Compound Name | actinium;(2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide |
|---|---|
| PubChem CID | 59916037 |
| Molecular Formula | C14H21AcN6O3S- |
| Molecular Weight | 580.43 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | actinium;(2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide |
| SMILES | NC(N)=NCCCC(NC(=O)[C@@H]1CC(O)C[N-]1)C(=O)c1nccs1.[Ac] |
| InChI | InChI=1S/C14H21N6O3S.Ac/c15-14(16)18-3-1-2-9(11(22)13-17-4-5-24-13)20-12(23)10-6-8(21)7-19-10;/h4-5,8-10,21H,1-3,6-7H2,(H,20,23)(H4,15,16,18);/q-1;/t8?,9?,10-;/m0./s1 |
| InChIKey | SGEJIVXEKYRFPU-IMUQEULPSA-N |
| XLogP | -0.63 |
| TPSA | 157.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.43 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|