C13H23N5O5 — CID 69042765
(2S)-2-[[(2S)-1-acetyl-4-hydroxypyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 69042765) has the molecular formula C13H23N5O5 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-acetyl-4-hydroxypyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-acetyl-4-hydroxypyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 69042765 |
| Molecular Formula | C13H23N5O5 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2S)-2-[[(2S)-1-acetyl-4-hydroxypyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)N1CC(O)C[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C13H23N5O5/c1-7(19)18-6-8(20)5-10(18)11(21)17-9(12(22)23)3-2-4-16-13(14)15/h8-10,20H,2-6H2,1H3,(H,17,21)(H,22,23)(H4,14,15,16)/t8?,9-,10-/m0/s1 |
| InChIKey | CUQRVLCQGGZUHE-AGROOBSYSA-N |
| XLogP | -2.41 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|