C23H25F2N3O8 — CID 134356492
N-[1-(2,6-difluorophenoxy)-7-formamido-2-oxoheptan-3-yl]-3-[(2,2,2-trihydroxyacetyl)amino]benzamide (PubChem CID 134356492) has the molecular formula C23H25F2N3O8 and a molecular weight of 509.46 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenoxy)-7-formamido-2-oxoheptan-3-yl]-3-[(2,2,2-trihydroxyacetyl)amino]benzamide.
| Compound Name | N-[1-(2,6-difluorophenoxy)-7-formamido-2-oxoheptan-3-yl]-3-[(2,2,2-trihydroxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 134356492 |
| Molecular Formula | C23H25F2N3O8 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[1-(2,6-difluorophenoxy)-7-formamido-2-oxoheptan-3-yl]-3-[(2,2,2-trihydroxyacetyl)amino]benzamide |
| SMILES | O=CNCCCCC(NC(=O)c1cccc(NC(=O)C(O)(O)O)c1)C(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C23H25F2N3O8/c24-16-7-4-8-17(25)20(16)36-12-19(30)18(9-1-2-10-26-13-29)28-21(31)14-5-3-6-15(11-14)27-22(32)23(33,34)35/h3-8,11,13,18,33-35H,1-2,9-10,12H2,(H,26,29)(H,27,32)(H,28,31) |
| InChIKey | RBAAVDADYKUNPT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 174.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|