C17H22ClN3O7 — CID 142307544
N-(1-chloro-7-formamido-2-oxoheptan-3-yl)-3-[(2,2,2-trihydroxyacetyl)amino]benzamide (PubChem CID 142307544) has the molecular formula C17H22ClN3O7 and a molecular weight of 415.83 g/mol. Its IUPAC name is N-(1-chloro-7-formamido-2-oxoheptan-3-yl)-3-[(2,2,2-trihydroxyacetyl)amino]benzamide.
| Compound Name | N-(1-chloro-7-formamido-2-oxoheptan-3-yl)-3-[(2,2,2-trihydroxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 142307544 |
| Molecular Formula | C17H22ClN3O7 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-(1-chloro-7-formamido-2-oxoheptan-3-yl)-3-[(2,2,2-trihydroxyacetyl)amino]benzamide |
| SMILES | O=CNCCCCC(NC(=O)c1cccc(NC(=O)C(O)(O)O)c1)C(=O)CCl |
| InChI | InChI=1S/C17H22ClN3O7/c18-9-14(23)13(6-1-2-7-19-10-22)21-15(24)11-4-3-5-12(8-11)20-16(25)17(26,27)28/h3-5,8,10,13,26-28H,1-2,6-7,9H2,(H,19,22)(H,20,25)(H,21,24) |
| InChIKey | GRYPOKSSUQELSK-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|