C28H34F2N6O5 — CID 134356549
tert-butyl N-[(5R)-5-[[3-[4-(aminomethyl)triazol-1-yl]benzoyl]amino]-7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate (PubChem CID 134356549) has the molecular formula C28H34F2N6O5 and a molecular weight of 572.61 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-[[3-[4-(aminomethyl)triazol-1-yl]benzoyl]amino]-7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-[[3-[4-(aminomethyl)triazol-1-yl]benzoyl]amino]-7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 134356549 |
| Molecular Formula | C28H34F2N6O5 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | tert-butyl N-[(5R)-5-[[3-[4-(aminomethyl)triazol-1-yl]benzoyl]amino]-7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](NC(=O)c1cccc(-n2cc(CN)nn2)c1)C(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C28H34F2N6O5/c1-28(2,3)41-27(39)32-13-5-4-12-23(24(37)17-40-25-21(29)10-7-11-22(25)30)33-26(38)18-8-6-9-20(14-18)36-16-19(15-31)34-35-36/h6-11,14,16,23H,4-5,12-13,15,17,31H2,1-3H3,(H,32,39)(H,33,38)/t23-/m1/s1 |
| InChIKey | HEOFPBOQHLKCPT-HSZRJFAPSA-N |
| XLogP | 3.45 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|