C27H35F2N3O6 — CID 142307622
3-acetamidobenzamide;tert-butyl N-[7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate (PubChem CID 142307622) has the molecular formula C27H35F2N3O6 and a molecular weight of 535.59 g/mol. Its IUPAC name is 3-acetamidobenzamide;tert-butyl N-[7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate.
| Compound Name | 3-acetamidobenzamide;tert-butyl N-[7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 142307622 |
| Molecular Formula | C27H35F2N3O6 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 3-acetamidobenzamide;tert-butyl N-[7-(2,6-difluorophenoxy)-6-oxoheptyl]carbamate |
| SMILES | CC(=O)Nc1cccc(C(N)=O)c1.CC(C)(C)OC(=O)NCCCCCC(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C18H25F2NO4.C9H10N2O2/c1-18(2,3)25-17(23)21-11-6-4-5-8-13(22)12-24-16-14(19)9-7-10-15(16)20;1-6(12)11-8-4-2-3-7(5-8)9(10)13/h7,9-10H,4-6,8,11-12H2,1-3H3,(H,21,23);2-5H,1H3,(H2,10,13)(H,11,12) |
| InChIKey | BWPCHFXTVULQTJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|