C18H27F2NO4 — CID 142307522
tert-butyl N-[7-(2,6-difluorocyclohexa-1,5-dien-1-yl)oxy-6-oxoheptyl]carbamate (PubChem CID 142307522) has the molecular formula C18H27F2NO4 and a molecular weight of 359.41 g/mol. Its IUPAC name is tert-butyl N-[7-(2,6-difluorocyclohexa-1,5-dien-1-yl)oxy-6-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[7-(2,6-difluorocyclohexa-1,5-dien-1-yl)oxy-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 142307522 |
| Molecular Formula | C18H27F2NO4 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | tert-butyl N-[7-(2,6-difluorocyclohexa-1,5-dien-1-yl)oxy-6-oxoheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)COC1=C(F)CCC=C1F |
| InChI | InChI=1S/C18H27F2NO4/c1-18(2,3)25-17(23)21-11-6-4-5-8-13(22)12-24-16-14(19)9-7-10-15(16)20/h9H,4-8,10-12H2,1-3H3,(H,21,23) |
| InChIKey | TUSWDNCBZBRHAE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|