C16H24FN3O4 — CID 134356569
tert-butyl N-[7-(5-fluoro-6-oxopyrimidin-1-yl)-6-oxoheptyl]carbamate (PubChem CID 134356569) has the molecular formula C16H24FN3O4 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl N-[7-(5-fluoro-6-oxopyrimidin-1-yl)-6-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[7-(5-fluoro-6-oxopyrimidin-1-yl)-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 134356569 |
| Molecular Formula | C16H24FN3O4 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | tert-butyl N-[7-(5-fluoro-6-oxopyrimidin-1-yl)-6-oxoheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)Cn1cncc(F)c1=O |
| InChI | InChI=1S/C16H24FN3O4/c1-16(2,3)24-15(23)19-8-6-4-5-7-12(21)10-20-11-18-9-13(17)14(20)22/h9,11H,4-8,10H2,1-3H3,(H,19,23) |
| InChIKey | JHZXKKRRJZRUHK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|