C17H25N3O4 — CID 158154704
tert-butyl N-[(2S)-3-oxo-6-(pyridine-3-carbonylamino)hexan-2-yl]carbamate (PubChem CID 158154704) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-oxo-6-(pyridine-3-carbonylamino)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-oxo-6-(pyridine-3-carbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 158154704 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl N-[(2S)-3-oxo-6-(pyridine-3-carbonylamino)hexan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)CCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C17H25N3O4/c1-12(20-16(23)24-17(2,3)4)14(21)8-6-10-19-15(22)13-7-5-9-18-11-13/h5,7,9,11-12H,6,8,10H2,1-4H3,(H,19,22)(H,20,23)/t12-/m0/s1 |
| InChIKey | UPGGLRNFDQXOTJ-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|