C16H23N3O7S — CID 164741064
methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitrothiophene-2-carbonyl)amino]pentanoate (PubChem CID 164741064) has the molecular formula C16H23N3O7S and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitrothiophene-2-carbonyl)amino]pentanoate.
| Compound Name | methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitrothiophene-2-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 164741064 |
| Molecular Formula | C16H23N3O7S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitrothiophene-2-carbonyl)amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCNC(=O)OC(C)(C)C)NC(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H23N3O7S/c1-16(2,3)26-15(22)17-9-5-6-10(14(21)25-4)18-13(20)11-7-8-12(27-11)19(23)24/h7-8,10H,5-6,9H2,1-4H3,(H,17,22)(H,18,20)/t10-/m0/s1 |
| InChIKey | FQVQJIMAHRWJEN-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|