C14H23NO3 — CID 77070699
3-[(hexa-2,4-dienoylamino)methyl]-5-methylhexanoic acid (PubChem CID 77070699) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-[(hexa-2,4-dienoylamino)methyl]-5-methylhexanoic acid.
| Compound Name | 3-[(hexa-2,4-dienoylamino)methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 77070699 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-[(hexa-2,4-dienoylamino)methyl]-5-methylhexanoic acid |
| SMILES | CC=CC=CC(=O)NCC(CC(=O)O)CC(C)C |
| InChI | InChI=1S/C14H23NO3/c1-4-5-6-7-13(16)15-10-12(8-11(2)3)9-14(17)18/h4-7,11-12H,8-10H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | KJCWYXMGYJOYTC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|