C15H22N2O3S — CID 77071057
5-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]methyl]hexanoic acid (PubChem CID 77071057) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]methyl]hexanoic acid.
| Compound Name | 5-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]methyl]hexanoic acid |
|---|---|
| PubChem CID | 77071057 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]methyl]hexanoic acid |
| SMILES | Cc1nc(C=CC(=O)NCC(CC(=O)O)CC(C)C)cs1 |
| InChI | InChI=1S/C15H22N2O3S/c1-10(2)6-12(7-15(19)20)8-16-14(18)5-4-13-9-21-11(3)17-13/h4-5,9-10,12H,6-8H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | MEKKPROTGIGFBA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|