C9H15NO3 — CID 139812822
(2S,3S)-2-(3-deuterioprop-2-enoylamino)-3-methylpentanoic acid (PubChem CID 139812822) has the molecular formula C9H15NO3 and a molecular weight of 186.23 g/mol. Its IUPAC name is (2S,3S)-2-(3-deuterioprop-2-enoylamino)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-(3-deuterioprop-2-enoylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 139812822 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2S,3S)-2-(3-deuterioprop-2-enoylamino)-3-methylpentanoic acid |
| SMILES | [2H]/C=C/C(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C9H15NO3/c1-4-6(3)8(9(12)13)10-7(11)5-2/h5-6,8H,2,4H2,1,3H3,(H,10,11)(H,12,13)/t6-,8-/m0/s1/i2D/b5-2+ |
| InChIKey | XBGOFJJLPHWJRB-BSORPFBKSA-N |
| XLogP | 0.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|