About dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol
dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol (PubChem CID 175353339) has the molecular formula C9H15Cl2O5P
and a molecular weight of 305.09 g/mol. Its IUPAC name is dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol.
Molecular Properties
| Compound Name | dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol |
| PubChem CID | 175353339 |
| Molecular Formula | C9H15Cl2O5P |
| Molecular Weight | 305.09 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)COCC=C.O=P(O)(Cl)Cl |
| InChI | InChI=1S/C9H14O3.Cl2HO2P/c1-3-5-11-7-9(10)8-12-6-4-2;1-5(2,3)4/h1,4,9-10H,2,5-8H2;(H,3,4) |
| InChIKey | UYUBAXUOHJNDRC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol?
The IUPAC name of dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol (CID 175353339) is dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol.
What is the SMILES notation for dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol?
The canonical SMILES for dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol is C#CCOCC(O)COCC=C.O=P(O)(Cl)Cl.
What is the InChIKey of dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol?
The InChIKey is UYUBAXUOHJNDRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3.Cl2HO2P/c1-3-5-11-7-9(10)8-12-6-4-2;1-5(2,3)4/h1,4,9-10H,2,5-8H2;(H,3,4).
What are the key properties of dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol?
dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol has a molecular weight of 305.09 g/mol, XLogP of 1.76, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorophosphinic acid;1-prop-2-enoxy-3-prop-2-ynoxypropan-2-ol is sourced from PubChem (CID 175353339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).