C40H108O8PSi12+ — CID 88887480
tetrakis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]phosphanium (PubChem CID 88887480) has the molecular formula C40H108O8PSi12+ and a molecular weight of 1085.30 g/mol. Its IUPAC name is tetrakis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]phosphanium.
| Compound Name | tetrakis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]phosphanium |
|---|---|
| PubChem CID | 88887480 |
| Molecular Formula | C40H108O8PSi12+ |
| Molecular Weight | 1085.30 g/mol |
| Exact Mass | 1083.50 |
| IUPAC Name | tetrakis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]phosphanium |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCC[P+](CCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)(CCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)CCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C40H108O8PSi12/c1-50(2,3)41-58(21,22)45-54(13,14)37-29-33-49(34-30-38-55(15,16)46-59(23,24)42-51(4,5)6,35-31-39-56(17,18)47-60(25,26)43-52(7,8)9)36-32-40-57(19,20)48-61(27,28)44-53(10,11)12/h29-40H2,1-28H3/q+1 |
| InChIKey | ZDLBAOPTBMVMBD-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.30 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|