C27H66O8Si4 — CID 123576942
2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-[[2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-(hydroxymethyl)butyl]peroxymethyl]butan-1-ol;methane (PubChem CID 123576942) has the molecular formula C27H66O8Si4 and a molecular weight of 631.16 g/mol. Its IUPAC name is 2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-[[2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-(hydroxymethyl)butyl]peroxymethyl]butan-1-ol;methane.
| Compound Name | 2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-[[2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-(hydroxymethyl)butyl]peroxymethyl]butan-1-ol;methane |
|---|---|
| PubChem CID | 123576942 |
| Molecular Formula | C27H66O8Si4 |
| Molecular Weight | 631.16 g/mol |
| Exact Mass | 630.38 |
| IUPAC Name | 2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-[[2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-2-(hydroxymethyl)butyl]peroxymethyl]butan-1-ol;methane |
| SMILES | C.CCC(CO)(COOCC(CC)(CO)OCCC[Si](C)(C)O[Si](C)(C)C)OCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H62O8Si4.CH4/c1-13-25(21-27,29-17-15-19-37(9,10)33-35(3,4)5)23-31-32-24-26(14-2,22-28)30-18-16-20-38(11,12)34-36(6,7)8;/h27-28H,13-24H2,1-12H3;1H4 |
| InChIKey | DAZQTWKSWPQGOU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.16 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|