C23H54O5Si3 — CID 58975336
6-[[6-hydroxyhexyl-[6-hydroxyhexyl(dimethyl)silyl]oxy-methylsilyl]oxy-dimethylsilyl]hexan-1-ol (PubChem CID 58975336) has the molecular formula C23H54O5Si3 and a molecular weight of 494.94 g/mol. Its IUPAC name is 6-[[6-hydroxyhexyl-[6-hydroxyhexyl(dimethyl)silyl]oxy-methylsilyl]oxy-dimethylsilyl]hexan-1-ol.
| Compound Name | 6-[[6-hydroxyhexyl-[6-hydroxyhexyl(dimethyl)silyl]oxy-methylsilyl]oxy-dimethylsilyl]hexan-1-ol |
|---|---|
| PubChem CID | 58975336 |
| Molecular Formula | C23H54O5Si3 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | 6-[[6-hydroxyhexyl-[6-hydroxyhexyl(dimethyl)silyl]oxy-methylsilyl]oxy-dimethylsilyl]hexan-1-ol |
| SMILES | C[Si](C)(CCCCCCO)O[Si](C)(CCCCCCO)O[Si](C)(C)CCCCCCO |
| InChI | InChI=1S/C23H54O5Si3/c1-29(2,21-15-9-6-12-18-24)27-31(5,23-17-11-8-14-20-26)28-30(3,4)22-16-10-7-13-19-25/h24-26H,6-23H2,1-5H3 |
| InChIKey | SBLJZUALZWHZLW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|