C14H34O5Si2 — CID 165045281
2-[3-[[3-ethenoxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethanol;hydrate (PubChem CID 165045281) has the molecular formula C14H34O5Si2 and a molecular weight of 338.59 g/mol. Its IUPAC name is 2-[3-[[3-ethenoxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethanol;hydrate.
| Compound Name | 2-[3-[[3-ethenoxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethanol;hydrate |
|---|---|
| PubChem CID | 165045281 |
| Molecular Formula | C14H34O5Si2 |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-[3-[[3-ethenoxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethanol;hydrate |
| SMILES | C=COCCC[Si](C)(C)O[Si](C)(C)CCCOCCO.O |
| InChI | InChI=1S/C14H32O4Si2.H2O/c1-6-16-10-7-13-19(2,3)18-20(4,5)14-8-11-17-12-9-15;/h6,15H,1,7-14H2,2-5H3;1H2 |
| InChIKey | YZURGUBKKGLXTE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|