C19H50O9Si5 — CID 157187405
2-[3-[[[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methyl-methylsilyloxysilyl]oxymethoxy-dimethylsilyl]propoxy]ethanol (PubChem CID 157187405) has the molecular formula C19H50O9Si5 and a molecular weight of 563.03 g/mol. Its IUPAC name is 2-[3-[[[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methyl-methylsilyloxysilyl]oxymethoxy-dimethylsilyl]propoxy]ethanol.
| Compound Name | 2-[3-[[[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methyl-methylsilyloxysilyl]oxymethoxy-dimethylsilyl]propoxy]ethanol |
|---|---|
| PubChem CID | 157187405 |
| Molecular Formula | C19H50O9Si5 |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-[3-[[[[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-methyl-methylsilyloxysilyl]oxymethoxy-dimethylsilyl]propoxy]ethanol |
| SMILES | C[SiH2]O[Si@@](C)(OCO[Si](C)(C)CCCOCCO)O[Si](C)(C)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C19H50O9Si5/c1-29-26-33(8,25-19-24-30(2,3)17-9-13-22-15-11-20)28-32(6,7)27-31(4,5)18-10-14-23-16-12-21/h20-21H,9-19,29H2,1-8H3/t33-/m1/s1 |
| InChIKey | VLEVBHPRMGBVAX-MGBGTMOVSA-N |
| XLogP | 2.64 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|