C13H35O7Si6 — CID 59850394
CID 59850394 (PubChem CID 59850394) has the molecular formula C13H35O7Si6 and a molecular weight of 471.93 g/mol.
| Compound Name | CID 59850394 |
|---|---|
| PubChem CID | 59850394 |
| Molecular Formula | C13H35O7Si6 |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | — |
| SMILES | C[Si]O[Si](C)(C)O[Si@@](C)(O[Si]C)O[Si](C)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C13H35O7Si6/c1-21-16-25(6,7)20-26(8,17-22-2)19-23(3)18-24(4,5)13-9-11-15-12-10-14/h14H,9-13H2,1-8H3/t26-/m0/s1 |
| InChIKey | WJAJHNNBFBAOHQ-SANMLTNESA-N |
| XLogP | 2.40 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|