C29H65O12Si3 — CID 58059369
CID 58059369 (PubChem CID 58059369) has the molecular formula C29H65O12Si3 and a molecular weight of 690.08 g/mol.
| Compound Name | CID 58059369 |
|---|---|
| PubChem CID | 58059369 |
| Molecular Formula | C29H65O12Si3 |
| Molecular Weight | 690.08 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](C)(C)O[Si](C)(CCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O[Si](C)C |
| InChI | InChI=1S/C29H65O12Si3/c1-29(2)43(5,6)41-44(7,40-42(3)4)28-8-10-31-12-14-33-16-18-35-20-22-37-24-26-39-27-25-38-23-21-36-19-17-34-15-13-32-11-9-30/h29-30H,8-28H2,1-7H3 |
| InChIKey | ZUYPYIIGWVFGRG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|