C14H40O7Si6 — CID 123762580
CID 123762580 (PubChem CID 123762580) has the molecular formula C14H40O7Si6 and a molecular weight of 488.98 g/mol.
| Compound Name | CID 123762580 |
|---|---|
| PubChem CID | 123762580 |
| Molecular Formula | C14H40O7Si6 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | — |
| SMILES | C[SiH]O[Si](C)(C)O[Si@@](C)(O[SiH]C)O[Si](C)(C)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C14H40O7Si6/c1-22-17-25(5,6)20-27(9,18-23-2)21-26(7,8)19-24(3,4)14-10-12-16-13-11-15/h15,22-23H,10-14H2,1-9H3/t27-/m1/s1 |
| InChIKey | GTRSJALSOPWGOU-HHHXNRCGSA-N |
| XLogP | 2.44 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|