C13H40O7Si6 — CID 123943383
2-[3-[[[[dimethyl(methylsilyloxy)silyl]oxy-methyl-methylsilyloxysilyl]oxy-methylsilyl]oxy-dimethylsilyl]propoxy]ethanol (PubChem CID 123943383) has the molecular formula C13H40O7Si6 and a molecular weight of 476.97 g/mol. Its IUPAC name is 2-[3-[[[[dimethyl(methylsilyloxy)silyl]oxy-methyl-methylsilyloxysilyl]oxy-methylsilyl]oxy-dimethylsilyl]propoxy]ethanol.
| Compound Name | 2-[3-[[[[dimethyl(methylsilyloxy)silyl]oxy-methyl-methylsilyloxysilyl]oxy-methylsilyl]oxy-dimethylsilyl]propoxy]ethanol |
|---|---|
| PubChem CID | 123943383 |
| Molecular Formula | C13H40O7Si6 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[3-[[[[dimethyl(methylsilyloxy)silyl]oxy-methyl-methylsilyloxysilyl]oxy-methylsilyl]oxy-dimethylsilyl]propoxy]ethanol |
| SMILES | C[SiH2]O[Si](C)(C)O[Si@@](C)(O[SiH2]C)O[SiH](C)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C13H40O7Si6/c1-21-16-25(6,7)20-26(8,17-22-2)19-23(3)18-24(4,5)13-9-11-15-12-10-14/h14,23H,9-13,21-22H2,1-8H3/t23?,26-/m0/s1 |
| InChIKey | PKFQLVWYXKGUEN-NASUQTAISA-N |
| XLogP | 1.06 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|